About 9H-fluoren-1-yl carbonochloridate
9H-fluoren-1-yl carbonochloridate (PubChem CID 57317054) has the molecular formula C14H9ClO2
and a molecular weight of 244.68 g/mol. Its IUPAC name is 9H-fluoren-1-yl carbonochloridate.
Molecular Properties
| Compound Name | 9H-fluoren-1-yl carbonochloridate |
| PubChem CID | 57317054 |
| Molecular Formula | C14H9ClO2 |
| Molecular Weight | 244.68 g/mol |
| Exact Mass | 244.03 |
| IUPAC Name | 9H-fluoren-1-yl carbonochloridate |
| SMILES | O=C(Cl)Oc1cccc2c1Cc1ccccc1-2 |
| InChI | InChI=1S/C14H9ClO2/c15-14(16)17-13-7-3-6-11-10-5-2-1-4-9(10)8-12(11)13/h1-7H,8H2 |
| InChIKey | PZLGXHXQNCNYND-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.68 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 9H-fluoren-1-yl carbonochloridate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-fluoren-1-yl carbonochloridate?
The IUPAC name of 9H-fluoren-1-yl carbonochloridate (CID 57317054) is 9H-fluoren-1-yl carbonochloridate.
What is the SMILES notation for 9H-fluoren-1-yl carbonochloridate?
The canonical SMILES for 9H-fluoren-1-yl carbonochloridate is O=C(Cl)Oc1cccc2c1Cc1ccccc1-2.
What is the InChIKey of 9H-fluoren-1-yl carbonochloridate?
The InChIKey is PZLGXHXQNCNYND-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9ClO2/c15-14(16)17-13-7-3-6-11-10-5-2-1-4-9(10)8-12(11)13/h1-7H,8H2.
What are the key properties of 9H-fluoren-1-yl carbonochloridate?
9H-fluoren-1-yl carbonochloridate has a molecular weight of 244.68 g/mol, XLogP of 4.00, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-fluoren-1-yl carbonochloridate is sourced from PubChem (CID 57317054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).