About N'-(3,4-dihydro-1H-isothiochromen-4-yl)butane-1,4-diamine
N'-(3,4-dihydro-1H-isothiochromen-4-yl)butane-1,4-diamine (PubChem CID 60894193) has the molecular formula C13H20N2S
and a molecular weight of 236.38 g/mol. Its IUPAC name is N'-(3,4-dihydro-1H-isothiochromen-4-yl)butane-1,4-diamine.
Molecular Properties
| Compound Name | N'-(3,4-dihydro-1H-isothiochromen-4-yl)butane-1,4-diamine |
| PubChem CID | 60894193 |
| Molecular Formula | C13H20N2S |
| Molecular Weight | 236.38 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | N'-(3,4-dihydro-1H-isothiochromen-4-yl)butane-1,4-diamine |
| SMILES | NCCCCNC1CSCc2ccccc21 |
| InChI | InChI=1S/C13H20N2S/c14-7-3-4-8-15-13-10-16-9-11-5-1-2-6-12(11)13/h1-2,5-6,13,15H,3-4,7-10,14H2 |
| InChIKey | NAGTYPXGAFCCNT-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.38 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-(3,4-dihydro-1H-isothiochromen-4-yl)butane-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(3,4-dihydro-1H-isothiochromen-4-yl)butane-1,4-diamine?
The IUPAC name of N'-(3,4-dihydro-1H-isothiochromen-4-yl)butane-1,4-diamine (CID 60894193) is N'-(3,4-dihydro-1H-isothiochromen-4-yl)butane-1,4-diamine.
What is the SMILES notation for N'-(3,4-dihydro-1H-isothiochromen-4-yl)butane-1,4-diamine?
The canonical SMILES for N'-(3,4-dihydro-1H-isothiochromen-4-yl)butane-1,4-diamine is NCCCCNC1CSCc2ccccc21.
What is the InChIKey of N'-(3,4-dihydro-1H-isothiochromen-4-yl)butane-1,4-diamine?
The InChIKey is NAGTYPXGAFCCNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2S/c14-7-3-4-8-15-13-10-16-9-11-5-1-2-6-12(11)13/h1-2,5-6,13,15H,3-4,7-10,14H2.
What are the key properties of N'-(3,4-dihydro-1H-isothiochromen-4-yl)butane-1,4-diamine?
N'-(3,4-dihydro-1H-isothiochromen-4-yl)butane-1,4-diamine has a molecular weight of 236.38 g/mol, XLogP of 2.30, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(3,4-dihydro-1H-isothiochromen-4-yl)butane-1,4-diamine is sourced from PubChem (CID 60894193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).