C16H21N — CID 22864481
(1R,2S)-N,1-bis(prop-2-enyl)-1,2,3,4-tetrahydronaphthalen-2-amine (PubChem CID 22864481) has the molecular formula C16H21N and a molecular weight of 227.35 g/mol. Its IUPAC name is (1R,2S)-N,1-bis(prop-2-enyl)-1,2,3,4-tetrahydronaphthalen-2-amine.
| Compound Name | (1R,2S)-N,1-bis(prop-2-enyl)-1,2,3,4-tetrahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 22864481 |
| Molecular Formula | C16H21N |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | (1R,2S)-N,1-bis(prop-2-enyl)-1,2,3,4-tetrahydronaphthalen-2-amine |
| SMILES | C=CCN[C@H]1CCc2ccccc2[C@H]1CC=C |
| InChI | InChI=1S/C16H21N/c1-3-7-15-14-9-6-5-8-13(14)10-11-16(15)17-12-4-2/h3-6,8-9,15-17H,1-2,7,10-12H2/t15-,16+/m1/s1 |
| InChIKey | JONSUOPOTLJXPM-CVEARBPZSA-N |
| XLogP | 3.44 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|