C13H16 — CID 138977422
(1R)-1-prop-2-enyl-1,2,3,4-tetrahydronaphthalene (PubChem CID 138977422) has the molecular formula C13H16 and a molecular weight of 172.27 g/mol. Its IUPAC name is (1R)-1-prop-2-enyl-1,2,3,4-tetrahydronaphthalene.
| Compound Name | (1R)-1-prop-2-enyl-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 138977422 |
| Molecular Formula | C13H16 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.13 |
| IUPAC Name | (1R)-1-prop-2-enyl-1,2,3,4-tetrahydronaphthalene |
| SMILES | C=CC[C@H]1CCCc2ccccc21 |
| InChI | InChI=1S/C13H16/c1-2-6-11-8-5-9-12-7-3-4-10-13(11)12/h2-4,7,10-11H,1,5-6,8-9H2/t11-/m0/s1 |
| InChIKey | WYYNQXVVZCYEAC-NSHDSACASA-N |
| XLogP | 3.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|