C14H20 — CID 54453127
1-(2-methylpropyl)-1,2,3,4-tetrahydronaphthalene (PubChem CID 54453127) has the molecular formula C14H20 and a molecular weight of 188.31 g/mol. Its IUPAC name is 1-(2-methylpropyl)-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 1-(2-methylpropyl)-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 54453127 |
| Molecular Formula | C14H20 |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.16 |
| IUPAC Name | 1-(2-methylpropyl)-1,2,3,4-tetrahydronaphthalene |
| SMILES | CC(C)CC1CCCc2ccccc21 |
| InChI | InChI=1S/C14H20/c1-11(2)10-13-8-5-7-12-6-3-4-9-14(12)13/h3-4,6,9,11,13H,5,7-8,10H2,1-2H3 |
| InChIKey | WWIASMBZYOCWQO-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |