C20H24O — CID 63902024
3-phenyl-1-(1,2,3,4-tetrahydronaphthalen-1-yl)butan-2-ol (PubChem CID 63902024) has the molecular formula C20H24O and a molecular weight of 280.41 g/mol. Its IUPAC name is 3-phenyl-1-(1,2,3,4-tetrahydronaphthalen-1-yl)butan-2-ol.
| Compound Name | 3-phenyl-1-(1,2,3,4-tetrahydronaphthalen-1-yl)butan-2-ol |
|---|---|
| PubChem CID | 63902024 |
| Molecular Formula | C20H24O |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 3-phenyl-1-(1,2,3,4-tetrahydronaphthalen-1-yl)butan-2-ol |
| SMILES | CC(c1ccccc1)C(O)CC1CCCc2ccccc21 |
| InChI | InChI=1S/C20H24O/c1-15(16-8-3-2-4-9-16)20(21)14-18-12-7-11-17-10-5-6-13-19(17)18/h2-6,8-10,13,15,18,20-21H,7,11-12,14H2,1H3 |
| InChIKey | NILLBPVVGXKRCU-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |