C17H26O3 — CID 79495849
1,1-diethoxy-3-(1,2,3,4-tetrahydronaphthalen-1-yl)propan-2-ol (PubChem CID 79495849) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is 1,1-diethoxy-3-(1,2,3,4-tetrahydronaphthalen-1-yl)propan-2-ol.
| Compound Name | 1,1-diethoxy-3-(1,2,3,4-tetrahydronaphthalen-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 79495849 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | 1,1-diethoxy-3-(1,2,3,4-tetrahydronaphthalen-1-yl)propan-2-ol |
| SMILES | CCOC(OCC)C(O)CC1CCCc2ccccc21 |
| InChI | InChI=1S/C17H26O3/c1-3-19-17(20-4-2)16(18)12-14-10-7-9-13-8-5-6-11-15(13)14/h5-6,8,11,14,16-18H,3-4,7,9-10,12H2,1-2H3 |
| InChIKey | DDMVWZSEPZGXOA-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|