C17H26O — CID 63902035
1-(1,2,3,4-tetrahydronaphthalen-1-yl)heptan-2-ol (PubChem CID 63902035) has the molecular formula C17H26O and a molecular weight of 246.39 g/mol. Its IUPAC name is 1-(1,2,3,4-tetrahydronaphthalen-1-yl)heptan-2-ol.
| Compound Name | 1-(1,2,3,4-tetrahydronaphthalen-1-yl)heptan-2-ol |
|---|---|
| PubChem CID | 63902035 |
| Molecular Formula | C17H26O |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.20 |
| IUPAC Name | 1-(1,2,3,4-tetrahydronaphthalen-1-yl)heptan-2-ol |
| SMILES | CCCCCC(O)CC1CCCc2ccccc21 |
| InChI | InChI=1S/C17H26O/c1-2-3-4-11-16(18)13-15-10-7-9-14-8-5-6-12-17(14)15/h5-6,8,12,15-16,18H,2-4,7,9-11,13H2,1H3 |
| InChIKey | GMVZJSFSNVSHEG-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|