C16H24 — CID 58420594
5-pentyl-6,7,8,9-tetrahydro-5H-benzo[7]annulene (PubChem CID 58420594) has the molecular formula C16H24 and a molecular weight of 216.37 g/mol. Its IUPAC name is 5-pentyl-6,7,8,9-tetrahydro-5H-benzo[7]annulene.
| Compound Name | 5-pentyl-6,7,8,9-tetrahydro-5H-benzo[7]annulene |
|---|---|
| PubChem CID | 58420594 |
| Molecular Formula | C16H24 |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.19 |
| IUPAC Name | 5-pentyl-6,7,8,9-tetrahydro-5H-benzo[7]annulene |
| SMILES | CCCCCC1CCCCc2ccccc21 |
| InChI | InChI=1S/C16H24/c1-2-3-4-9-14-10-5-6-11-15-12-7-8-13-16(14)15/h7-8,12-14H,2-6,9-11H2,1H3 |
| InChIKey | GGZOAISTOAXUIB-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|