C18H28 — CID 71392483
1-ethyl-4-hexyl-1,2,3,4-tetrahydronaphthalene (PubChem CID 71392483) has the molecular formula C18H28 and a molecular weight of 244.42 g/mol. Its IUPAC name is 1-ethyl-4-hexyl-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 1-ethyl-4-hexyl-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 71392483 |
| Molecular Formula | C18H28 |
| Molecular Weight | 244.42 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | 1-ethyl-4-hexyl-1,2,3,4-tetrahydronaphthalene |
| SMILES | CCCCCCC1CCC(CC)c2ccccc21 |
| InChI | InChI=1S/C18H28/c1-3-5-6-7-10-16-14-13-15(4-2)17-11-8-9-12-18(16)17/h8-9,11-12,15-16H,3-7,10,13-14H2,1-2H3 |
| InChIKey | LWKBYDDGGFHLDI-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.42 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|