C15H23N — CID 106778499
2-methyl-4-pentyl-1,2,3,4-tetrahydroquinoline (PubChem CID 106778499) has the molecular formula C15H23N and a molecular weight of 217.36 g/mol. Its IUPAC name is 2-methyl-4-pentyl-1,2,3,4-tetrahydroquinoline.
| Compound Name | 2-methyl-4-pentyl-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 106778499 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | 2-methyl-4-pentyl-1,2,3,4-tetrahydroquinoline |
| SMILES | CCCCCC1CC(C)Nc2ccccc21 |
| InChI | InChI=1S/C15H23N/c1-3-4-5-8-13-11-12(2)16-15-10-7-6-9-14(13)15/h6-7,9-10,12-13,16H,3-5,8,11H2,1-2H3 |
| InChIKey | XKFKKRWCNUGKKG-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|