C14H21NO — CID 25242139
(2R,4S)-4-butoxy-2-methyl-1,2,3,4-tetrahydroquinoline (PubChem CID 25242139) has the molecular formula C14H21NO and a molecular weight of 219.33 g/mol. Its IUPAC name is (2R,4S)-4-butoxy-2-methyl-1,2,3,4-tetrahydroquinoline.
| Compound Name | (2R,4S)-4-butoxy-2-methyl-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 25242139 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | (2R,4S)-4-butoxy-2-methyl-1,2,3,4-tetrahydroquinoline |
| SMILES | CCCCO[C@H]1C[C@@H](C)Nc2ccccc21 |
| InChI | InChI=1S/C14H21NO/c1-3-4-9-16-14-10-11(2)15-13-8-6-5-7-12(13)14/h5-8,11,14-15H,3-4,9-10H2,1-2H3/t11-,14+/m1/s1 |
| InChIKey | XYTFVKLBNBQBTM-RISCZKNCSA-N |
| XLogP | 3.75 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|