C14H20O — CID 122208722
7-hexoxybicyclo[4.2.0]octa-1,3,5-triene (PubChem CID 122208722) has the molecular formula C14H20O and a molecular weight of 204.31 g/mol. Its IUPAC name is 7-hexoxybicyclo[4.2.0]octa-1,3,5-triene.
| Compound Name | 7-hexoxybicyclo[4.2.0]octa-1,3,5-triene |
|---|---|
| PubChem CID | 122208722 |
| Molecular Formula | C14H20O |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | 7-hexoxybicyclo[4.2.0]octa-1,3,5-triene |
| SMILES | CCCCCCOC1Cc2ccccc21 |
| InChI | InChI=1S/C14H20O/c1-2-3-4-7-10-15-14-11-12-8-5-6-9-13(12)14/h5-6,8-9,14H,2-4,7,10-11H2,1H3 |
| InChIKey | MKZCENSNEVGVBU-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|