C17H27NO — CID 43127864
6-hexoxy-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-amine (PubChem CID 43127864) has the molecular formula C17H27NO and a molecular weight of 261.41 g/mol. Its IUPAC name is 6-hexoxy-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-amine.
| Compound Name | 6-hexoxy-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-amine |
|---|---|
| PubChem CID | 43127864 |
| Molecular Formula | C17H27NO |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.21 |
| IUPAC Name | 6-hexoxy-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-amine |
| SMILES | CCCCCCOC1CCCc2ccccc2C1N |
| InChI | InChI=1S/C17H27NO/c1-2-3-4-7-13-19-16-12-8-10-14-9-5-6-11-15(14)17(16)18/h5-6,9,11,16-17H,2-4,7-8,10,12-13,18H2,1H3 |
| InChIKey | RTNNOMIALNYWNR-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|