C28H40N2O2 — CID 146597119
(1R,2R)-2-[10-[[(1R,2R)-1-amino-2,3-dihydro-1H-inden-2-yl]oxy]decoxy]-2,3-dihydro-1H-inden-1-amine (PubChem CID 146597119) has the molecular formula C28H40N2O2 and a molecular weight of 436.64 g/mol. Its IUPAC name is (1R,2R)-2-[10-[[(1R,2R)-1-amino-2,3-dihydro-1H-inden-2-yl]oxy]decoxy]-2,3-dihydro-1H-inden-1-amine.
| Compound Name | (1R,2R)-2-[10-[[(1R,2R)-1-amino-2,3-dihydro-1H-inden-2-yl]oxy]decoxy]-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 146597119 |
| Molecular Formula | C28H40N2O2 |
| Molecular Weight | 436.64 g/mol |
| Exact Mass | 436.31 |
| IUPAC Name | (1R,2R)-2-[10-[[(1R,2R)-1-amino-2,3-dihydro-1H-inden-2-yl]oxy]decoxy]-2,3-dihydro-1H-inden-1-amine |
| SMILES | N[C@@H]1c2ccccc2C[C@H]1OCCCCCCCCCCO[C@@H]1Cc2ccccc2[C@H]1N |
| InChI | InChI=1S/C28H40N2O2/c29-27-23-15-9-7-13-21(23)19-25(27)31-17-11-5-3-1-2-4-6-12-18-32-26-20-22-14-8-10-16-24(22)28(26)30/h7-10,13-16,25-28H,1-6,11-12,17-20,29-30H2/t25-,26-,27-,28-/m1/s1 |
| InChIKey | MLPPEBNQHGJSDF-BIYDSLDMSA-N |
| XLogP | 5.39 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.64 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|