C19H29Cl — CID 63460402
1-chloro-2-decyl-2,3-dihydro-1H-indene (PubChem CID 63460402) has the molecular formula C19H29Cl and a molecular weight of 292.89 g/mol. Its IUPAC name is 1-chloro-2-decyl-2,3-dihydro-1H-indene.
| Compound Name | 1-chloro-2-decyl-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 63460402 |
| Molecular Formula | C19H29Cl |
| Molecular Weight | 292.89 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | 1-chloro-2-decyl-2,3-dihydro-1H-indene |
| SMILES | CCCCCCCCCCC1Cc2ccccc2C1Cl |
| InChI | InChI=1S/C19H29Cl/c1-2-3-4-5-6-7-8-9-13-17-15-16-12-10-11-14-18(16)19(17)20/h10-12,14,17,19H,2-9,13,15H2,1H3 |
| InChIKey | PRSDBLZMQSNAQY-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.89 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|