C19H30O — CID 64986848
1-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)undecan-1-ol (PubChem CID 64986848) has the molecular formula C19H30O and a molecular weight of 274.45 g/mol. Its IUPAC name is 1-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)undecan-1-ol.
| Compound Name | 1-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)undecan-1-ol |
|---|---|
| PubChem CID | 64986848 |
| Molecular Formula | C19H30O |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.23 |
| IUPAC Name | 1-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)undecan-1-ol |
| SMILES | CCCCCCCCCCC(O)C1Cc2ccccc21 |
| InChI | InChI=1S/C19H30O/c1-2-3-4-5-6-7-8-9-14-19(20)18-15-16-12-10-11-13-17(16)18/h10-13,18-20H,2-9,14-15H2,1H3 |
| InChIKey | OZZGVDJECZRBJN-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|