C20H33N — CID 64984494
1-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)-N-methylundecan-1-amine (PubChem CID 64984494) has the molecular formula C20H33N and a molecular weight of 287.49 g/mol. Its IUPAC name is 1-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)-N-methylundecan-1-amine.
| Compound Name | 1-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)-N-methylundecan-1-amine |
|---|---|
| PubChem CID | 64984494 |
| Molecular Formula | C20H33N |
| Molecular Weight | 287.49 g/mol |
| Exact Mass | 287.26 |
| IUPAC Name | 1-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)-N-methylundecan-1-amine |
| SMILES | CCCCCCCCCCC(NC)C1Cc2ccccc21 |
| InChI | InChI=1S/C20H33N/c1-3-4-5-6-7-8-9-10-15-20(21-2)19-16-17-13-11-12-14-18(17)19/h11-14,19-21H,3-10,15-16H2,1-2H3 |
| InChIKey | WYUVAMJGCYBMKL-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.49 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|