C17H27N — CID 65410934
1-(2,3-dihydro-1H-inden-2-yl)-N-ethylhexan-1-amine (PubChem CID 65410934) has the molecular formula C17H27N and a molecular weight of 245.41 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-2-yl)-N-ethylhexan-1-amine.
| Compound Name | 1-(2,3-dihydro-1H-inden-2-yl)-N-ethylhexan-1-amine |
|---|---|
| PubChem CID | 65410934 |
| Molecular Formula | C17H27N |
| Molecular Weight | 245.41 g/mol |
| Exact Mass | 245.21 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-2-yl)-N-ethylhexan-1-amine |
| SMILES | CCCCCC(NCC)C1Cc2ccccc2C1 |
| InChI | InChI=1S/C17H27N/c1-3-5-6-11-17(18-4-2)16-12-14-9-7-8-10-15(14)13-16/h7-10,16-18H,3-6,11-13H2,1-2H3 |
| InChIKey | PSMOBFJDVOERHB-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.41 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|