C14H21N — CID 65410925
1-(2,3-dihydro-1H-inden-2-yl)-N-ethylpropan-1-amine (PubChem CID 65410925) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-2-yl)-N-ethylpropan-1-amine.
| Compound Name | 1-(2,3-dihydro-1H-inden-2-yl)-N-ethylpropan-1-amine |
|---|---|
| PubChem CID | 65410925 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-2-yl)-N-ethylpropan-1-amine |
| SMILES | CCNC(CC)C1Cc2ccccc2C1 |
| InChI | InChI=1S/C14H21N/c1-3-14(15-4-2)13-9-11-7-5-6-8-12(11)10-13/h5-8,13-15H,3-4,9-10H2,1-2H3 |
| InChIKey | HETPGNFRMXTWCL-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |