C15H23NS — CID 105130052
1-(2,3-dihydro-1-benzothiophen-2-yl)-N-methylhexan-1-amine (PubChem CID 105130052) has the molecular formula C15H23NS and a molecular weight of 249.42 g/mol. Its IUPAC name is 1-(2,3-dihydro-1-benzothiophen-2-yl)-N-methylhexan-1-amine.
| Compound Name | 1-(2,3-dihydro-1-benzothiophen-2-yl)-N-methylhexan-1-amine |
|---|---|
| PubChem CID | 105130052 |
| Molecular Formula | C15H23NS |
| Molecular Weight | 249.42 g/mol |
| Exact Mass | 249.16 |
| IUPAC Name | 1-(2,3-dihydro-1-benzothiophen-2-yl)-N-methylhexan-1-amine |
| SMILES | CCCCCC(NC)C1Cc2ccccc2S1 |
| InChI | InChI=1S/C15H23NS/c1-3-4-5-9-13(16-2)15-11-12-8-6-7-10-14(12)17-15/h6-8,10,13,15-16H,3-5,9,11H2,1-2H3 |
| InChIKey | DMCACJLKTSPKML-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.42 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|