C19H30OS — CID 105089949
1-(2,3-dihydro-1-benzothiophen-2-yl)undecan-1-ol (PubChem CID 105089949) has the molecular formula C19H30OS and a molecular weight of 306.51 g/mol. Its IUPAC name is 1-(2,3-dihydro-1-benzothiophen-2-yl)undecan-1-ol.
| Compound Name | 1-(2,3-dihydro-1-benzothiophen-2-yl)undecan-1-ol |
|---|---|
| PubChem CID | 105089949 |
| Molecular Formula | C19H30OS |
| Molecular Weight | 306.51 g/mol |
| Exact Mass | 306.20 |
| IUPAC Name | 1-(2,3-dihydro-1-benzothiophen-2-yl)undecan-1-ol |
| SMILES | CCCCCCCCCCC(O)C1Cc2ccccc2S1 |
| InChI | InChI=1S/C19H30OS/c1-2-3-4-5-6-7-8-9-13-17(20)19-15-16-12-10-11-14-18(16)21-19/h10-12,14,17,19-20H,2-9,13,15H2,1H3 |
| InChIKey | MGLGQNMTXRUJOD-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.51 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|