C16H22O2S — CID 105104857
1-(2,3-dihydro-1-benzothiophen-2-yl)-4-(oxolan-2-yl)butan-1-ol (PubChem CID 105104857) has the molecular formula C16H22O2S and a molecular weight of 278.42 g/mol. Its IUPAC name is 1-(2,3-dihydro-1-benzothiophen-2-yl)-4-(oxolan-2-yl)butan-1-ol.
| Compound Name | 1-(2,3-dihydro-1-benzothiophen-2-yl)-4-(oxolan-2-yl)butan-1-ol |
|---|---|
| PubChem CID | 105104857 |
| Molecular Formula | C16H22O2S |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 1-(2,3-dihydro-1-benzothiophen-2-yl)-4-(oxolan-2-yl)butan-1-ol |
| SMILES | OC(CCCC1CCCO1)C1Cc2ccccc2S1 |
| InChI | InChI=1S/C16H22O2S/c17-14(8-3-6-13-7-4-10-18-13)16-11-12-5-1-2-9-15(12)19-16/h1-2,5,9,13-14,16-17H,3-4,6-8,10-11H2 |
| InChIKey | KOMXVRAMFOBGTD-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |