C15H15NOS — CID 105108065
1-(2,3-dihydro-1-benzothiophen-2-yl)-2-pyridin-4-ylethanol (PubChem CID 105108065) has the molecular formula C15H15NOS and a molecular weight of 257.36 g/mol. Its IUPAC name is 1-(2,3-dihydro-1-benzothiophen-2-yl)-2-pyridin-4-ylethanol.
| Compound Name | 1-(2,3-dihydro-1-benzothiophen-2-yl)-2-pyridin-4-ylethanol |
|---|---|
| PubChem CID | 105108065 |
| Molecular Formula | C15H15NOS |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | 1-(2,3-dihydro-1-benzothiophen-2-yl)-2-pyridin-4-ylethanol |
| SMILES | OC(Cc1ccncc1)C1Cc2ccccc2S1 |
| InChI | InChI=1S/C15H15NOS/c17-13(9-11-5-7-16-8-6-11)15-10-12-3-1-2-4-14(12)18-15/h1-8,13,15,17H,9-10H2 |
| InChIKey | YPUKZFDHJNQRHW-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |