C14H18Cl2O2 — CID 65162393
1-(2,6-dichlorophenyl)-4-(oxolan-2-yl)butan-1-ol (PubChem CID 65162393) has the molecular formula C14H18Cl2O2 and a molecular weight of 289.20 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)-4-(oxolan-2-yl)butan-1-ol.
| Compound Name | 1-(2,6-dichlorophenyl)-4-(oxolan-2-yl)butan-1-ol |
|---|---|
| PubChem CID | 65162393 |
| Molecular Formula | C14H18Cl2O2 |
| Molecular Weight | 289.20 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 1-(2,6-dichlorophenyl)-4-(oxolan-2-yl)butan-1-ol |
| SMILES | OC(CCCC1CCCO1)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C14H18Cl2O2/c15-11-6-2-7-12(16)14(11)13(17)8-1-4-10-5-3-9-18-10/h2,6-7,10,13,17H,1,3-5,8-9H2 |
| InChIKey | BWSCZGJAMFXLOP-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.20 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |