C14H18ClFO2 — CID 65161658
1-(4-chloro-3-fluorophenyl)-4-(oxolan-2-yl)butan-1-ol (PubChem CID 65161658) has the molecular formula C14H18ClFO2 and a molecular weight of 272.75 g/mol. Its IUPAC name is 1-(4-chloro-3-fluorophenyl)-4-(oxolan-2-yl)butan-1-ol.
| Compound Name | 1-(4-chloro-3-fluorophenyl)-4-(oxolan-2-yl)butan-1-ol |
|---|---|
| PubChem CID | 65161658 |
| Molecular Formula | C14H18ClFO2 |
| Molecular Weight | 272.75 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 1-(4-chloro-3-fluorophenyl)-4-(oxolan-2-yl)butan-1-ol |
| SMILES | OC(CCCC1CCCO1)c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C14H18ClFO2/c15-12-7-6-10(9-13(12)16)14(17)5-1-3-11-4-2-8-18-11/h6-7,9,11,14,17H,1-5,8H2 |
| InChIKey | LFRXUQWLTINTLW-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.75 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |