C9H10ClFO2 — CID 86696659
(1S)-1-(4-chloro-3-fluorophenyl)propane-1,3-diol (PubChem CID 86696659) has the molecular formula C9H10ClFO2 and a molecular weight of 204.63 g/mol. Its IUPAC name is (1S)-1-(4-chloro-3-fluorophenyl)propane-1,3-diol.
| Compound Name | (1S)-1-(4-chloro-3-fluorophenyl)propane-1,3-diol |
|---|---|
| PubChem CID | 86696659 |
| Molecular Formula | C9H10ClFO2 |
| Molecular Weight | 204.63 g/mol |
| Exact Mass | 204.04 |
| IUPAC Name | (1S)-1-(4-chloro-3-fluorophenyl)propane-1,3-diol |
| SMILES | OCC[C@H](O)c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C9H10ClFO2/c10-7-2-1-6(5-8(7)11)9(13)3-4-12/h1-2,5,9,12-13H,3-4H2/t9-/m0/s1 |
| InChIKey | IYZLUGCBNLJQIQ-VIFPVBQESA-N |
| XLogP | 1.89 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.63 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |