C9H11ClFNO2 — CID 95933939
(1S,2S)-2-amino-1-(4-chloro-3-fluorophenyl)propane-1,3-diol (PubChem CID 95933939) has the molecular formula C9H11ClFNO2 and a molecular weight of 219.64 g/mol. Its IUPAC name is (1S,2S)-2-amino-1-(4-chloro-3-fluorophenyl)propane-1,3-diol.
| Compound Name | (1S,2S)-2-amino-1-(4-chloro-3-fluorophenyl)propane-1,3-diol |
|---|---|
| PubChem CID | 95933939 |
| Molecular Formula | C9H11ClFNO2 |
| Molecular Weight | 219.64 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | (1S,2S)-2-amino-1-(4-chloro-3-fluorophenyl)propane-1,3-diol |
| SMILES | N[C@@H](CO)[C@@H](O)c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C9H11ClFNO2/c10-6-2-1-5(3-7(6)11)9(14)8(12)4-13/h1-3,8-9,13-14H,4,12H2/t8-,9-/m0/s1 |
| InChIKey | LXRBJLLDUYVYTH-IUCAKERBSA-N |
| XLogP | 0.83 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.64 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |