C8H8ClFO2 — CID 97286939
(1S)-1-(4-chloro-3-fluorophenyl)ethane-1,2-diol (PubChem CID 97286939) has the molecular formula C8H8ClFO2 and a molecular weight of 190.60 g/mol. Its IUPAC name is (1S)-1-(4-chloro-3-fluorophenyl)ethane-1,2-diol.
| Compound Name | (1S)-1-(4-chloro-3-fluorophenyl)ethane-1,2-diol |
|---|---|
| PubChem CID | 97286939 |
| Molecular Formula | C8H8ClFO2 |
| Molecular Weight | 190.60 g/mol |
| Exact Mass | 190.02 |
| IUPAC Name | (1S)-1-(4-chloro-3-fluorophenyl)ethane-1,2-diol |
| SMILES | OC[C@@H](O)c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C8H8ClFO2/c9-6-2-1-5(3-7(6)10)8(12)4-11/h1-3,8,11-12H,4H2/t8-/m1/s1 |
| InChIKey | ZNGGAPYUQROFJC-MRVPVSSYSA-N |
| XLogP | 1.50 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.60 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |