C9H11ClFNO — CID 62773520
1-(4-chloro-3-fluorophenyl)-2-(methylamino)ethanol (PubChem CID 62773520) has the molecular formula C9H11ClFNO and a molecular weight of 203.64 g/mol. Its IUPAC name is 1-(4-chloro-3-fluorophenyl)-2-(methylamino)ethanol.
| Compound Name | 1-(4-chloro-3-fluorophenyl)-2-(methylamino)ethanol |
|---|---|
| PubChem CID | 62773520 |
| Molecular Formula | C9H11ClFNO |
| Molecular Weight | 203.64 g/mol |
| Exact Mass | 203.05 |
| IUPAC Name | 1-(4-chloro-3-fluorophenyl)-2-(methylamino)ethanol |
| SMILES | CNCC(O)c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C9H11ClFNO/c1-12-5-9(13)6-2-3-7(10)8(11)4-6/h2-4,9,12-13H,5H2,1H3 |
| InChIKey | OYEMEPJCSGRFHL-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.64 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |