C14H13ClFNO3S — CID 97248769
N-[(2S)-2-(4-chloro-3-fluorophenyl)-2-hydroxyethyl]benzenesulfonamide (PubChem CID 97248769) has the molecular formula C14H13ClFNO3S and a molecular weight of 329.78 g/mol. Its IUPAC name is N-[(2S)-2-(4-chloro-3-fluorophenyl)-2-hydroxyethyl]benzenesulfonamide.
| Compound Name | N-[(2S)-2-(4-chloro-3-fluorophenyl)-2-hydroxyethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 97248769 |
| Molecular Formula | C14H13ClFNO3S |
| Molecular Weight | 329.78 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | N-[(2S)-2-(4-chloro-3-fluorophenyl)-2-hydroxyethyl]benzenesulfonamide |
| SMILES | O=S(=O)(NC[C@@H](O)c1ccc(Cl)c(F)c1)c1ccccc1 |
| InChI | InChI=1S/C14H13ClFNO3S/c15-12-7-6-10(8-13(12)16)14(18)9-17-21(19,20)11-4-2-1-3-5-11/h1-8,14,17-18H,9H2/t14-/m1/s1 |
| InChIKey | LHUDWSIXLVCAMQ-CQSZACIVSA-N |
| XLogP | 2.49 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.78 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |