C10H12ClFO3 — CID 171871880
1-(4-chloro-3-fluorophenyl)butane-1,2,4-triol (PubChem CID 171871880) has the molecular formula C10H12ClFO3 and a molecular weight of 234.65 g/mol. Its IUPAC name is 1-(4-chloro-3-fluorophenyl)butane-1,2,4-triol.
| Compound Name | 1-(4-chloro-3-fluorophenyl)butane-1,2,4-triol |
|---|---|
| PubChem CID | 171871880 |
| Molecular Formula | C10H12ClFO3 |
| Molecular Weight | 234.65 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | 1-(4-chloro-3-fluorophenyl)butane-1,2,4-triol |
| SMILES | OCCC(O)C(O)c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C10H12ClFO3/c11-7-2-1-6(5-8(7)12)10(15)9(14)3-4-13/h1-2,5,9-10,13-15H,3-4H2 |
| InChIKey | CQRCQUQCZCOXGM-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.65 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |