C10H14FNO3 — CID 171872014
1-(3-amino-4-fluorophenyl)butane-1,2,4-triol (PubChem CID 171872014) has the molecular formula C10H14FNO3 and a molecular weight of 215.22 g/mol. Its IUPAC name is 1-(3-amino-4-fluorophenyl)butane-1,2,4-triol.
| Compound Name | 1-(3-amino-4-fluorophenyl)butane-1,2,4-triol |
|---|---|
| PubChem CID | 171872014 |
| Molecular Formula | C10H14FNO3 |
| Molecular Weight | 215.22 g/mol |
| Exact Mass | 215.10 |
| IUPAC Name | 1-(3-amino-4-fluorophenyl)butane-1,2,4-triol |
| SMILES | Nc1cc(C(O)C(O)CCO)ccc1F |
| InChI | InChI=1S/C10H14FNO3/c11-7-2-1-6(5-8(7)12)10(15)9(14)3-4-13/h1-2,5,9-10,13-15H,3-4,12H2 |
| InChIKey | SLXYNNKJFLMPRP-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.22 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|