C9H13FN2O3 — CID 171871936
1-(6-amino-5-fluoro-3-pyridinyl)butane-1,2,4-triol (PubChem CID 171871936) has the molecular formula C9H13FN2O3 and a molecular weight of 216.21 g/mol. Its IUPAC name is 1-(6-amino-5-fluoro-3-pyridinyl)butane-1,2,4-triol.
| Compound Name | 1-(6-amino-5-fluoro-3-pyridinyl)butane-1,2,4-triol |
|---|---|
| PubChem CID | 171871936 |
| Molecular Formula | C9H13FN2O3 |
| Molecular Weight | 216.21 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 1-(6-amino-5-fluoro-3-pyridinyl)butane-1,2,4-triol |
| SMILES | Nc1ncc(C(O)C(O)CCO)cc1F |
| InChI | InChI=1S/C9H13FN2O3/c10-6-3-5(4-12-9(6)11)8(15)7(14)1-2-13/h3-4,7-8,13-15H,1-2H2,(H2,11,12) |
| InChIKey | NFPQXCQYRPSVNM-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.21 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |