C8H12ClN3O3 — CID 171872100
1-(5-amino-6-chloropyrazin-2-yl)butane-1,2,4-triol (PubChem CID 171872100) has the molecular formula C8H12ClN3O3 and a molecular weight of 233.65 g/mol. Its IUPAC name is 1-(5-amino-6-chloropyrazin-2-yl)butane-1,2,4-triol.
| Compound Name | 1-(5-amino-6-chloropyrazin-2-yl)butane-1,2,4-triol |
|---|---|
| PubChem CID | 171872100 |
| Molecular Formula | C8H12ClN3O3 |
| Molecular Weight | 233.65 g/mol |
| Exact Mass | 233.06 |
| IUPAC Name | 1-(5-amino-6-chloropyrazin-2-yl)butane-1,2,4-triol |
| SMILES | Nc1ncc(C(O)C(O)CCO)nc1Cl |
| InChI | InChI=1S/C8H12ClN3O3/c9-7-8(10)11-3-4(12-7)6(15)5(14)1-2-13/h3,5-6,13-15H,1-2H2,(H2,10,11) |
| InChIKey | DYABECUUFWIPBQ-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 112.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.65 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |