C9H14ClN3O2 — CID 171880901
4-amino-1-(5-amino-6-chloro-2-pyridinyl)butane-1,2-diol (PubChem CID 171880901) has the molecular formula C9H14ClN3O2 and a molecular weight of 231.68 g/mol. Its IUPAC name is 4-amino-1-(5-amino-6-chloro-2-pyridinyl)butane-1,2-diol.
| Compound Name | 4-amino-1-(5-amino-6-chloro-2-pyridinyl)butane-1,2-diol |
|---|---|
| PubChem CID | 171880901 |
| Molecular Formula | C9H14ClN3O2 |
| Molecular Weight | 231.68 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | 4-amino-1-(5-amino-6-chloro-2-pyridinyl)butane-1,2-diol |
| SMILES | NCCC(O)C(O)c1ccc(N)c(Cl)n1 |
| InChI | InChI=1S/C9H14ClN3O2/c10-9-5(12)1-2-6(13-9)8(15)7(14)3-4-11/h1-2,7-8,14-15H,3-4,11-12H2 |
| InChIKey | NFDPYLCWMOEIJD-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.68 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|