C8H10Cl2N2O2 — CID 171861679
1-(5-amino-6-chloro-2-pyridinyl)-3-chloropropane-1,2-diol (PubChem CID 171861679) has the molecular formula C8H10Cl2N2O2 and a molecular weight of 237.09 g/mol. Its IUPAC name is 1-(5-amino-6-chloro-2-pyridinyl)-3-chloropropane-1,2-diol.
| Compound Name | 1-(5-amino-6-chloro-2-pyridinyl)-3-chloropropane-1,2-diol |
|---|---|
| PubChem CID | 171861679 |
| Molecular Formula | C8H10Cl2N2O2 |
| Molecular Weight | 237.09 g/mol |
| Exact Mass | 236.01 |
| IUPAC Name | 1-(5-amino-6-chloro-2-pyridinyl)-3-chloropropane-1,2-diol |
| SMILES | Nc1ccc(C(O)C(O)CCl)nc1Cl |
| InChI | InChI=1S/C8H10Cl2N2O2/c9-3-6(13)7(14)5-2-1-4(11)8(10)12-5/h1-2,6-7,13-14H,3,11H2 |
| InChIKey | QDYQOJHBXUGWGW-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.09 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|