C7H10ClN3O2 — CID 171861554
1-(5-aminopyrazin-2-yl)-3-chloropropane-1,2-diol (PubChem CID 171861554) has the molecular formula C7H10ClN3O2 and a molecular weight of 203.63 g/mol. Its IUPAC name is 1-(5-aminopyrazin-2-yl)-3-chloropropane-1,2-diol.
| Compound Name | 1-(5-aminopyrazin-2-yl)-3-chloropropane-1,2-diol |
|---|---|
| PubChem CID | 171861554 |
| Molecular Formula | C7H10ClN3O2 |
| Molecular Weight | 203.63 g/mol |
| Exact Mass | 203.05 |
| IUPAC Name | 1-(5-aminopyrazin-2-yl)-3-chloropropane-1,2-diol |
| SMILES | Nc1cnc(C(O)C(O)CCl)cn1 |
| InChI | InChI=1S/C7H10ClN3O2/c8-1-5(12)7(13)4-2-11-6(9)3-10-4/h2-3,5,7,12-13H,1H2,(H2,9,11) |
| InChIKey | PJLKERPYIFEQSX-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.63 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|