C8H11ClN2O3 — CID 171861723
3-chloro-1-(2-methoxypyrimidin-5-yl)propane-1,2-diol (PubChem CID 171861723) has the molecular formula C8H11ClN2O3 and a molecular weight of 218.64 g/mol. Its IUPAC name is 3-chloro-1-(2-methoxypyrimidin-5-yl)propane-1,2-diol.
| Compound Name | 3-chloro-1-(2-methoxypyrimidin-5-yl)propane-1,2-diol |
|---|---|
| PubChem CID | 171861723 |
| Molecular Formula | C8H11ClN2O3 |
| Molecular Weight | 218.64 g/mol |
| Exact Mass | 218.05 |
| IUPAC Name | 3-chloro-1-(2-methoxypyrimidin-5-yl)propane-1,2-diol |
| SMILES | COc1ncc(C(O)C(O)CCl)cn1 |
| InChI | InChI=1S/C8H11ClN2O3/c1-14-8-10-3-5(4-11-8)7(13)6(12)2-9/h3-4,6-7,12-13H,2H2,1H3 |
| InChIKey | JKDKHHJGSGDLBS-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 75.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.64 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|