C10H14ClNO3 — CID 171862158
3-chloro-1-(6-methoxy-4-methyl-3-pyridinyl)propane-1,2-diol (PubChem CID 171862158) has the molecular formula C10H14ClNO3 and a molecular weight of 231.68 g/mol. Its IUPAC name is 3-chloro-1-(6-methoxy-4-methyl-3-pyridinyl)propane-1,2-diol.
| Compound Name | 3-chloro-1-(6-methoxy-4-methyl-3-pyridinyl)propane-1,2-diol |
|---|---|
| PubChem CID | 171862158 |
| Molecular Formula | C10H14ClNO3 |
| Molecular Weight | 231.68 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | 3-chloro-1-(6-methoxy-4-methyl-3-pyridinyl)propane-1,2-diol |
| SMILES | COc1cc(C)c(C(O)C(O)CCl)cn1 |
| InChI | InChI=1S/C10H14ClNO3/c1-6-3-9(15-2)12-5-7(6)10(14)8(13)4-11/h3,5,8,10,13-14H,4H2,1-2H3 |
| InChIKey | XHECQEJCZQPOFL-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 62.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.68 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|