C12H17ClO5 — CID 171863317
3-chloro-1-(2,4,5-trimethoxyphenyl)propane-1,2-diol (PubChem CID 171863317) has the molecular formula C12H17ClO5 and a molecular weight of 276.72 g/mol. Its IUPAC name is 3-chloro-1-(2,4,5-trimethoxyphenyl)propane-1,2-diol.
| Compound Name | 3-chloro-1-(2,4,5-trimethoxyphenyl)propane-1,2-diol |
|---|---|
| PubChem CID | 171863317 |
| Molecular Formula | C12H17ClO5 |
| Molecular Weight | 276.72 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | 3-chloro-1-(2,4,5-trimethoxyphenyl)propane-1,2-diol |
| SMILES | COc1cc(OC)c(C(O)C(O)CCl)cc1OC |
| InChI | InChI=1S/C12H17ClO5/c1-16-9-5-11(18-3)10(17-2)4-7(9)12(15)8(14)6-13/h4-5,8,12,14-15H,6H2,1-3H3 |
| InChIKey | GTIFKHZCUAMUNT-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.72 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|