C11H14ClFO4 — CID 171863279
3-chloro-1-(2-fluoro-4,5-dimethoxyphenyl)propane-1,2-diol (PubChem CID 171863279) has the molecular formula C11H14ClFO4 and a molecular weight of 264.68 g/mol. Its IUPAC name is 3-chloro-1-(2-fluoro-4,5-dimethoxyphenyl)propane-1,2-diol.
| Compound Name | 3-chloro-1-(2-fluoro-4,5-dimethoxyphenyl)propane-1,2-diol |
|---|---|
| PubChem CID | 171863279 |
| Molecular Formula | C11H14ClFO4 |
| Molecular Weight | 264.68 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | 3-chloro-1-(2-fluoro-4,5-dimethoxyphenyl)propane-1,2-diol |
| SMILES | COc1cc(F)c(C(O)C(O)CCl)cc1OC |
| InChI | InChI=1S/C11H14ClFO4/c1-16-9-3-6(11(15)8(14)5-12)7(13)4-10(9)17-2/h3-4,8,11,14-15H,5H2,1-2H3 |
| InChIKey | OTQPZCUKOLOPQH-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.68 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|