C17H19FO3 — CID 62865520
1-(2-fluoro-4,5-dimethoxyphenyl)-2-(4-methylphenyl)ethanol (PubChem CID 62865520) has the molecular formula C17H19FO3 and a molecular weight of 290.33 g/mol. Its IUPAC name is 1-(2-fluoro-4,5-dimethoxyphenyl)-2-(4-methylphenyl)ethanol.
| Compound Name | 1-(2-fluoro-4,5-dimethoxyphenyl)-2-(4-methylphenyl)ethanol |
|---|---|
| PubChem CID | 62865520 |
| Molecular Formula | C17H19FO3 |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 1-(2-fluoro-4,5-dimethoxyphenyl)-2-(4-methylphenyl)ethanol |
| SMILES | COc1cc(F)c(C(O)Cc2ccc(C)cc2)cc1OC |
| InChI | InChI=1S/C17H19FO3/c1-11-4-6-12(7-5-11)8-15(19)13-9-16(20-2)17(21-3)10-14(13)18/h4-7,9-10,15,19H,8H2,1-3H3 |
| InChIKey | RJIPVTPOFWFWSU-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |