C15H23FO3 — CID 114753416
1-(2-fluoro-4,5-dimethoxyphenyl)heptan-1-ol (PubChem CID 114753416) has the molecular formula C15H23FO3 and a molecular weight of 270.34 g/mol. Its IUPAC name is 1-(2-fluoro-4,5-dimethoxyphenyl)heptan-1-ol.
| Compound Name | 1-(2-fluoro-4,5-dimethoxyphenyl)heptan-1-ol |
|---|---|
| PubChem CID | 114753416 |
| Molecular Formula | C15H23FO3 |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | 1-(2-fluoro-4,5-dimethoxyphenyl)heptan-1-ol |
| SMILES | CCCCCCC(O)c1cc(OC)c(OC)cc1F |
| InChI | InChI=1S/C15H23FO3/c1-4-5-6-7-8-13(17)11-9-14(18-2)15(19-3)10-12(11)16/h9-10,13,17H,4-8H2,1-3H3 |
| InChIKey | DQSBVEPXFLUIHB-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|