C10H12F2O2S — CID 116831045
1-(2,5-difluoro-4-methoxyphenyl)-3-sulfanylpropan-1-ol (PubChem CID 116831045) has the molecular formula C10H12F2O2S and a molecular weight of 234.27 g/mol. Its IUPAC name is 1-(2,5-difluoro-4-methoxyphenyl)-3-sulfanylpropan-1-ol.
| Compound Name | 1-(2,5-difluoro-4-methoxyphenyl)-3-sulfanylpropan-1-ol |
|---|---|
| PubChem CID | 116831045 |
| Molecular Formula | C10H12F2O2S |
| Molecular Weight | 234.27 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | 1-(2,5-difluoro-4-methoxyphenyl)-3-sulfanylpropan-1-ol |
| SMILES | COc1cc(F)c(C(O)CCS)cc1F |
| InChI | InChI=1S/C10H12F2O2S/c1-14-10-5-7(11)6(4-8(10)12)9(13)2-3-15/h4-5,9,13,15H,2-3H2,1H3 |
| InChIKey | AFDBTDGVLYGBOC-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.27 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|