C11H13F3O — CID 19885905
1-(2,4,5-trifluorophenyl)pentan-1-ol (PubChem CID 19885905) has the molecular formula C11H13F3O and a molecular weight of 218.22 g/mol. Its IUPAC name is 1-(2,4,5-trifluorophenyl)pentan-1-ol.
| Compound Name | 1-(2,4,5-trifluorophenyl)pentan-1-ol |
|---|---|
| PubChem CID | 19885905 |
| Molecular Formula | C11H13F3O |
| Molecular Weight | 218.22 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 1-(2,4,5-trifluorophenyl)pentan-1-ol |
| SMILES | CCCCC(O)c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C11H13F3O/c1-2-3-4-11(15)7-5-9(13)10(14)6-8(7)12/h5-6,11,15H,2-4H2,1H3 |
| InChIKey | VVBJQIHMAJHZDK-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.22 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|