About diphenylmethanol
diphenylmethanol (PubChem CID 7037) has the molecular formula C13H12O
and a molecular weight of 184.24 g/mol. Its IUPAC name is diphenylmethanol.
Molecular Properties
| Compound Name | diphenylmethanol |
| PubChem CID | 7037 |
| Molecular Formula | C13H12O |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.09 |
| IUPAC Name | diphenylmethanol |
| SMILES | OC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C13H12O/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,13-14H |
| InChIKey | QILSFLSDHQAZET-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze diphenylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenylmethanol?
The IUPAC name of diphenylmethanol (CID 7037) is diphenylmethanol.
What is the SMILES notation for diphenylmethanol?
The canonical SMILES for diphenylmethanol is OC(c1ccccc1)c1ccccc1.
What is the InChIKey of diphenylmethanol?
The InChIKey is QILSFLSDHQAZET-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12O/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,13-14H.
What are the key properties of diphenylmethanol?
diphenylmethanol has a molecular weight of 184.24 g/mol, XLogP of 2.77, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for diphenylmethanol is sourced from PubChem (CID 7037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).