About Mandelonitrile
Mandelonitrile (PubChem CID 10758) has the molecular formula C8H7NO
and a molecular weight of 133.15 g/mol. Its IUPAC name is 2-hydroxy-2-phenylacetonitrile.
Molecular Properties
| Compound Name | Mandelonitrile |
| PubChem CID | 10758 |
| Molecular Formula | C8H7NO |
| Molecular Weight | 133.15 g/mol |
| Exact Mass | 133.05 |
| IUPAC Name | 2-hydroxy-2-phenylacetonitrile |
| SMILES | C1=CC=C(C=C1)C(C#N)O |
| InChI | InChI=1S/C8H7NO/c9-6-8(10)7-4-2-1-3-5-7/h1-5,8,10H |
| InChIKey | NNICRUQPODTGRU-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 44.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | 141 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.15 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|
Analyze Mandelonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Mandelonitrile?
The IUPAC name of Mandelonitrile (CID 10758) is 2-hydroxy-2-phenylacetonitrile.
What is the SMILES notation for Mandelonitrile?
The canonical SMILES for Mandelonitrile is C1=CC=C(C=C1)C(C#N)O.
What is the InChIKey of Mandelonitrile?
The InChIKey is NNICRUQPODTGRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO/c9-6-8(10)7-4-2-1-3-5-7/h1-5,8,10H.
What are the key properties of Mandelonitrile?
Mandelonitrile has a molecular weight of 133.15 g/mol, XLogP of 1.00, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for Mandelonitrile is sourced from PubChem (CID 10758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).