C14H20BrFO2 — CID 63447638
1-(1-bromohexyl)-2-fluoro-4,5-dimethoxybenzene (PubChem CID 63447638) has the molecular formula C14H20BrFO2 and a molecular weight of 319.21 g/mol. Its IUPAC name is 1-(1-bromohexyl)-2-fluoro-4,5-dimethoxybenzene.
| Compound Name | 1-(1-bromohexyl)-2-fluoro-4,5-dimethoxybenzene |
|---|---|
| PubChem CID | 63447638 |
| Molecular Formula | C14H20BrFO2 |
| Molecular Weight | 319.21 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | 1-(1-bromohexyl)-2-fluoro-4,5-dimethoxybenzene |
| SMILES | CCCCCC(Br)c1cc(OC)c(OC)cc1F |
| InChI | InChI=1S/C14H20BrFO2/c1-4-5-6-7-11(15)10-8-13(17-2)14(18-3)9-12(10)16/h8-9,11H,4-7H2,1-3H3 |
| InChIKey | CPGPJFHGZPURRM-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.21 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|