C14H20BrFO2 — CID 63447865
1-(1-bromo-3,3-dimethylbutyl)-2-fluoro-4,5-dimethoxybenzene (PubChem CID 63447865) has the molecular formula C14H20BrFO2 and a molecular weight of 319.21 g/mol. Its IUPAC name is 1-(1-bromo-3,3-dimethylbutyl)-2-fluoro-4,5-dimethoxybenzene.
| Compound Name | 1-(1-bromo-3,3-dimethylbutyl)-2-fluoro-4,5-dimethoxybenzene |
|---|---|
| PubChem CID | 63447865 |
| Molecular Formula | C14H20BrFO2 |
| Molecular Weight | 319.21 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | 1-(1-bromo-3,3-dimethylbutyl)-2-fluoro-4,5-dimethoxybenzene |
| SMILES | COc1cc(F)c(C(Br)CC(C)(C)C)cc1OC |
| InChI | InChI=1S/C14H20BrFO2/c1-14(2,3)8-10(15)9-6-12(17-4)13(18-5)7-11(9)16/h6-7,10H,8H2,1-5H3 |
| InChIKey | AZDGUAOLFXIRMS-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.21 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|